| Drug ID | DDPD00853 |
|
| Drug Name | Temozolomide | |
| Molecular Weight | 194.1508 | |
| Molecular Formula | C6H6N6O2 | |
| CAS Number | 85622-93-1 | |
| SMILES | CN1N=NC2=C(N=CN2C1=O)C(N)=O | |
| External Links | ||
| DRUGBANK | DB00853 | |
| PubChem Compound | 5394 | |
| PDR | 393 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -2.8 | - | -2.8 | - | DRUGBANK |
| Melting Point | 212.0 | ℃ | 212 | ℃ | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | 100 | % | PO, oral; | DRUGBANK |
| Clearance | 5.5 | L/h/m2 | 5.5 | L/h/m2 | DRUGBANK | Clearance | 0.22 | L/h/kg | 3.6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.40 | L/kg | 0.4 | L/kg | DRUGBANK | Volume of Distribution | 0.50 | L/kg | 0.5 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 1.8 | h | ~1.8 | h | DRUGBANK | Half-life | 1.5 | h | 1.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 37.7 | % | 37.7 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 0.80 | % | 0.8 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 15.0 | % | 15 | % | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 75.0 | mg/m2/day | 75 | mg/m2/day | PO, oral;intravenous injection, IV; | Temodar | temozolomide | PDR |
| Max dose for adults | 200.0 | mg/m2/day | 200 | mg/m2/day | PO, oral;intravenous injection, IV; | Temodar | temozolomide | PDR |
| Max dose for adults | 200.0 | mg/m2/day | 200 | mg/m2/day | PO, oral;intravenous injection, IV; | Temodar | temozolomide | PDR |
| Max dose for geriatric | 75.0 | mg/m2/day | 75 | mg/m2/day | PO, oral;intravenous injection, IV; | Temodar | temozolomide | PDR |
| Max dose for geriatric | 200.0 | mg/m2/day | 200 | mg/m2/day | PO, oral;intravenous injection, IV; | Temodar | temozolomide | PDR |
| Max dose for geriatric | 200.0 | mg/m2/day | 200 | mg/m2/day | PO, oral;intravenous injection, IV; | Temodar | temozolomide | PDR |