Basic Information
| Drug ID | DDPD00828 |
|
| Drug Name | Fosfomycin | |
| Molecular Weight | 138.059 | |
| Molecular Formula | C3H7O4P | |
| CAS Number | 23155-02-4 | |
| SMILES | C[C@@H]1O[C@@H]1P(O)(O)=O | |
| External Links | ||
| DRUGBANK | DB00828 | |
| PubChem Compound | 446987 | |
| PDR | 2434 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -1.6 | - | -1.6 | - | DRUGBANK |
| Melting Point | 94.0 | ℃ | 94 | ℃ | PhysProp |
| Water Solubility | 50000.0 | mg/L | 50 | mg/ml | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 37.0 | % | 37 | % | PO, oral; fasting; | DRUGBANK | |
| Bioavailability | 30.0 | % | 30 | % | PO, oral; food; | food ↓ ; | DRUGBANK |
| Metabolic | 0 | % | 0 | % | DRUGBANK | ||
| Clearance | 16.9 | L/h | 16.9±3.5 | L/h | DRUGBANK | ||
| Clearance | 0.12 | L/h/kg | 2 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 136.1 | L | 136.1±44.1 | L | DRUGBANK | ||
| Volume of Distribution | 0.32 | L/kg | 0.32 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Half-life | 5.7 | h | 5.7±2.8 | h | DRUGBANK | ||
| Half-life | 40.0 | h | 40 | h | elimination half-life; anuric; patients; | DRUGBANK | |
| Half-life | 1.9 | h | 1.9 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Toxicity LD50 | 5000.0 | mg/kg | >5 | g/kg | Rattus, Rat; | DRUGBANK | |
| Protein Binding | 0 | % | 0 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 3000.0 | mg/dose | 3 | g/dose | PO, oral | Monurol | fosfomycin tromethamine | PDR |
| Max dose for elderly | 3.0 | g/dose | 3 | g/dose | PO, oral | Monurol | fosfomycin tromethamine | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1