Basic Information
| Drug ID | DDPD00814 |
|
| Drug Name | Meloxicam | |
| Molecular Weight | 351.401 | |
| Molecular Formula | C14H13N3O4S2 | |
| CAS Number | 71125-38-7 | |
| SMILES | CN1C(C(=O)NC2=NC=C(C)S2)=C(O)C2=C(C=CC=C2)S1(=O)=O | |
| External Links | ||
| DRUGBANK | DB00814 | |
| T3DB | T3D2899 | |
| PubChem Compound | 54677470 | |
| PDR | 1245 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Caco-2 Permeability | -4.71 | - | -4.71 | - | ADME Research, USCD |
| Log P | 0.1 | - | 0.1 | - | https://www.accessdata.fda.gov/drugsatfda_docs/label/2004/20938s004lbl.pdf |
| Boiling Point | 581.3 | ℃ | 581.3±60.0 | ℃ | https://www.chemsrc.com/en/cas/71125-38-7_1083007.html |
| Melting Point | 256.0 | ℃ | 256 | ℃ | http://www.guildlink.com.au/gc/ws/by/pi.cfm?product=bypmobic10517 |
| Water Solubility | 22000.0 | mg/L | 22 | mg/ml | https://www.chemicalbook.com/ChemicalProductProperty_US_CB2191355.aspx |
| pKa | 4.08 | - | 4.08 | - | https://www.chemicalbook.com/ChemicalProductProperty_US_CB2191355.aspx |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 89.0 | % | 89 | % | PO, oral; | DRUGBANK | Bioavailability | 97.0 | % | 97.0 | % | PO, oral; | The Pharmacological Basis of Therapeutics |
| C Max | 1900.0 | ng/ml | 1.9±0.6 | mcg/ml | Capsule, PO, Oral; | The Pharmacological Basis of Therapeutics |
| T Max | 5.5 | h | 5-6 | h | PO, oral; | DRUGBANK | T Max | 7.0 | h | 5-9 | h | Capsule, PO, Oral; | The Pharmacological Basis of Therapeutics |
| Metabolic | 100.0 | % | ~100 | % | DRUGBANK | |
| Clearance | 0.45 | L/h | 0.42–0.48 | L/h | Total clearance; Oral single dose; | DRUGBANK | Clearance | 0.48 | L/h | 7.0-9 | ml/min | Plasma clearance; | DRUGBANK | Clearance | 0.006600 | L/h/kg | 0.10-0.12 | ml/min/kg | hydrolysis; hydrolysis; Male, men; Female, women; | The Pharmacological Basis of Therapeutics | Clearance | 0.007200 | L/h/kg | 0.12 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 12.5 | L | 10.0-15 | L | DRUGBANK | Volume of Distribution | 0.16 | L/kg | 0.15-0.16 | L/kg | hydrolysis; hydrolysis; Male, men; Female, women; | The Pharmacological Basis of Therapeutics | Volume of Distribution | 0.15 | L/kg | 0.15 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 20.0 | h | ~20 | h | DRUGBANK | Half-life | 16.5 | h | 15-18 | h | Male, men; Female, women; | The Pharmacological Basis of Therapeutics | Half-life | 18.0 | h | 18 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 98.0 | mg/kg | 98.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 84.0 | mg/kg | 84.0 | mg/kg | PO, oral; Rattus, Rat; | T3DB | Toxicity LD50 | 470.0 | mg/kg | 470.0 | mg/kg | PO, oral; mouse; | T3DB | Toxicity LD50 | 320.0 | mg/kg | 320.0 | mg/kg | PO, oral; rabbit; | T3DB |
| Eliminate Route | 0.25 | % | <0.25 | % | Urinary excretion; Unchanged drug; | DRUGBANK | Eliminate Route | 1.6 | % | ~1.6 | % | Faeces excretion; Unchanged drug; | DRUGBANK | Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; human, homo sapiens; Unchanged drug; | The Pharmacological Basis of Therapeutics |
| Protein Binding | 99.4 | % | ~99.4 | % | DRUGBANK | Protein Binding | 99.4 | % | ~99.4 | % | human, homo sapiens; | The Pharmacological Basis of Therapeutics |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 0.125 | mg/kg/day | 0.125 | mg/kg/day | Tablet,PO，oral;Liquid; | Mobic | meloxicam | PDR |
| Max dose for children | 7.5 | mg/day | 7.5 | mg/day | Tablet,PO，oral;Liquid; | Mobic | meloxicam | PDR |
| Max dose for adolescents | 0.125 | mg/kg/day | 0.125 | mg/kg/day | Tablet,PO，oral;Liquid; | Mobic | meloxicam | PDR |
| Max dose for adolescents | 7.5 | mg/day | 7.5 | mg/day | Tablet,PO，oral;Liquid; | Mobic | meloxicam | PDR |
| Max dose for adults | 15.0 | mg/day | 15 | mg/day | Tablet,PO，oral;Liquid; | Mobic | meloxicam | PDR |
| Max dose for adults | 10.0 | mg/day | 10 | mg/day | Capsule, PO, Oral | Mobic | meloxicam | PDR |
| Max dose for adults | 30.0 | mg/day | 30 | mg/day | intravenous injection, IV | Mobic | meloxicam | PDR |
| Max dose for geriatric | 15.0 | mg/day | 15 | mg/day | Tablet,PO，oral;Liquid; | Mobic | meloxicam | PDR |
| Max dose for geriatric | 10.0 | mg/day | 10 | mg/day | Capsule, PO, Oral | Mobic | meloxicam | PDR |
| Max dose for geriatric | 30.0 | mg/day | 30 | mg/day | intravenous injection, IV | Mobic | meloxicam | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1