Basic Information
| Drug ID | DDPD00697 |
|
| Drug Name | Tizanidine | |
| Molecular Weight | 253.711 | |
| Molecular Formula | C9H8ClN5S | |
| CAS Number | 51322-75-9 | |
| SMILES | ClC1=C(NC2=NCCN2)C2=NSN=C2C=C1 | |
| External Links | ||
| DRUGBANK | DB00697 | |
| T3DB | T3D2862 | |
| PubChem Compound | 5487 | |
| PDR | 3138 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.72 | - | 1.72 | - | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL1079/ |
| Boiling Point | 391.2 | ℃ | 391.2 | ℃ | https://www.lookchem.com/Tizanidine/ |
| Melting Point | 280.0 | ℃ | 280 | ℃ | https://www.lookchem.com/Tizanidine-hydrochloride/ |
| pKa | 7.48 | - | 7.48 | - | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL1079/ |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 40.0 | % | 40 | % | PO, oral; | DRUGBANK |
| Metabolic | 95.0 | % | 95 | % | Liver metabolism; | DRUGBANK |
| Clearance | 0.66 | L/h/kg | 11 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 2.4 | L/kg | 2.4 | L/kg | Steady state volume of distribution; | DRUGBANK | Volume of Distribution | 2.4 | L/kg | 2.4 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.5 | h | ~2.5 | h | DRUGBANK | Half-life | 2.4 | h | 2.4 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 414.0 | mg/kg | 414.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 282.0 | mg/kg | 282.0 | mg/kg | subcutaneous injection, SC; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 235.0 | mg/kg | 235.0 | mg/kg | PO, oral; mouse; | DRUGBANK |
| Protein Binding | 30.0 | % | ~30 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 36.0 | mg/day | 36 | mg/day | PO, oral | Tizanidine | tizanidine | PDR |
| Max dose for elderly | 36.0 | mg/day | 36 | mg/day | PO, oral | Tizanidine | tizanidine | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1