Basic Information
| Drug ID | DDPD00687 |
|
| Drug Name | Fludrocortisone | |
| Molecular Weight | 380.4504 | |
| Molecular Formula | C21H29FO5 | |
| CAS Number | 127-31-1 | |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)CC[C@]12C | |
| External Links | ||
| DRUGBANK | DB00687 | |
| PubChem Compound | 31378 | |
| PDR | 1272 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | 100 | % | PO, oral; | DRUGBANK |
| AUC | 2.1 | ng.h/ml | 1.22-3.07 | ug.h/L | PO, oral; | DRUGBANK |
| C Max | 0.10 | ng/ml | 0.0012-0.2 | ug/L | PO, oral; | DRUGBANK |
| T Max | 1.3 | h | 0.5-2 | h | PO, oral; | DRUGBANK |
| Clearance | 0.48 | L/h | 0.48 | L/h | Plasma clearance; | DRUGBANK |
| Volume of Distribution | 82.5 | L | 80-85 | L | Apparent volume of distribution; | DRUGBANK |
| Half-life | 2.3 | h | 1-3.5 | h | elimination half-life; | DRUGBANK | Half-life | 27.0 | h | 18-36 | h | DRUGBANK |
| Toxicity LD50 | 1000.0 | mg/kg | >1 | g/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 80.0 | % | ~80 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 20.0 | % | ~20 | % | Bile excretion; Faeces excretion; | DRUGBANK |
| Protein Binding | 75.0 | % | 70-80 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 0.3 | mg/day | 0.3 | mg/day | PO, oral | Fludrocortisone Acetate | fludrocortisone acetate | PDR |
| Max dose for children | 0.3 | mg/day | 0.3 | mg/day | PO, oral | Fludrocortisone Acetate | fludrocortisone acetate | PDR |
| Max dose for adolescents | 0.2 | mg/day | 0.2 | mg/day | PO, oral | Fludrocortisone Acetate | fludrocortisone acetate | PDR |
| Max dose for adults | 0.2 | mg/day | 0.2 | mg/day | PO, oral | Fludrocortisone Acetate | fludrocortisone acetate | PDR |
| Max dose for geriatric | 0.2 | mg/day | 0.2 | mg/day | PO, oral | Fludrocortisone Acetate | fludrocortisone acetate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1