| Drug ID | DDPD00649 |
|
| Drug Name | Stavudine | |
| Molecular Weight | 224.2133 | |
| Molecular Formula | C10H12N2O4 | |
| CAS Number | 3056-17-5 | |
| SMILES | CC1=CN([C@@H]2O[C@H](CO)C=C2)C(=O)NC1=O | |
| External Links | ||
| DRUGBANK | DB00649 | |
| T3DB | T3D4772 | |
| PubChem Compound | 18283 | |
| PDR | 914 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -0.72 | - | -0.72 | - | SANGSTER (1993) |
| Melting Point | 159.5 | ℃ | 159-160 | ℃ | DRUGBANK |
| Water Solubility | 75000.0 | mg/L | 5-10 | g/100ml | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 86.0 | % | 68-104 | % | DRUGBANK | |
| Clearance | 16.3 | L/h | 272.0 | ml/min | PO, oral; normal,healthy; rheumatoid arthritis; | DRUGBANK | Clearance | 35.6 | L/h | 594±164 | ml/min | intravenous infusion, IV in drop; AIDS,HIV; adults; pediatric patients; | DRUGBANK | Clearance | 0.59 | L/h | 9.75±3.76 | ml/min | intravenous infusion, IV in drop; AIDS,HIV; pediatric patients; | DRUGBANK | Clearance | 0.49 | L/h/kg | 8.2 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 46.0 | L | 46±21 | L | DRUGBANK | Volume of Distribution | 0.67 | L/kg | 0.67 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 1.2 | h | 0.8-1.5 | h | adults; | DRUGBANK | Half-life | 1.4 | h | 1.4 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for neonates | 2.0 | mg/kg/day | 2 | mg/kg/day | Liquid | Zerit | stavudine | PDR |
| Max dose for neonates | 1.0 | mg/kg/day | 1 | mg/kg/day | Liquid | Zerit | stavudine | PDR |
| Max dose for infants | 2.0 | mg/kg/day | 2 | mg/kg/day | Liquid | Zerit | stavudine | PDR |
| Max dose for children | 80.0 | mg/day | 80 | mg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for children | 60.0 | mg/day | 60 | mg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for children | 2.0 | mg/kg/day | 2 | mg/kg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for adolescents | 80.0 | mg/day | 80 | mg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for adolescents | 60.0 | mg/day | 60 | mg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for adolescents | 2.0 | mg/kg/day | 2 | mg/kg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for adults | 80.0 | mg/day | 80 | mg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for adults | 60.0 | mg/day | 60 | mg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for geriatric | 80.0 | mg/day | 80 | mg/day | PO, oral | Zerit | stavudine | PDR |
| Max dose for geriatric | 60.0 | mg/day | 60 | mg/day | PO, oral | Zerit | stavudine | PDR |