| Drug ID | DDPD00636 |
|
| Drug Name | Clofibrate | |
| Molecular Weight | 242.699 | |
| Molecular Formula | C12H15ClO3 | |
| CAS Number | 637-07-0 | |
| SMILES | CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 | |
| External Links | ||
| DRUGBANK | DB00636 | |
| T3DB | T3D4784 | |
| PubChem Compound | 2796 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 3.3 | - | 3.3 | - | DRUGBANK |
| Boiling Point | 149.0 | ℃ | 149 | ℃ | PhysProp |
| Melting Point | 118.5 | ℃ | 118-119 | ℃ | Jones, W.G.M.,Thorp, J.M. and Waring, W.S.; U.S. Patent 3,262,850; July 26, 1966; assigned to Imperial Chemical Industries Limited, England. |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | 100 | % | DRUGBANK | |
| Half-life | 24.5 | h | 18-22(14-35) | h | normal,healthy; | DRUGBANK |
| Toxicity LD50 | 1220.0 | mg/kg | 1220.0 | mg/kg | PO, oral; mouse; | DRUGBANK | Toxicity LD50 | 1370.0 | mg/kg | 1370.0 | mg/kg | PO, oral; rabbit; | DRUGBANK | Toxicity LD50 | 940.0 | mg/kg | 940.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 1220.0 | mg/kg | 1220.0 | mg/kg | PO, oral; mouse; | T3DB | Toxicity LD50 | 1370.0 | mg/kg | 1370.0 | mg/kg | PO, oral; rabbit; | T3DB | Toxicity LD50 | 940.0 | mg/kg | 940.0 | mg/kg | PO, oral; Rattus, Rat; | T3DB |
| Protein Binding | 96.0 | % | 95-97 | % | DRUGBANK |
Not Available