Basic Information
| Drug ID | DDPD00590 |
|
| Drug Name | Doxazosin | |
| Molecular Weight | 451.4751 | |
| Molecular Formula | C23H25N5O5 | |
| CAS Number | 74191-85-8 | |
| SMILES | COC1=C(OC)C=C2C(N)=NC(=NC2=C1)N1CCN(CC1)C(=O)C1COC2=CC=CC=C2O1 | |
| External Links | ||
| DRUGBANK | DB00590 | |
| PubChem Compound | 3157 | |
| PDR | 1849 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.1 | - | 2.1 | - | https://pubchem.ncbi.nlm.nih.gov/compound/Doxazosin |
| Boiling Point | 718.0 | ℃ | 718 | ℃ | https://www.scbt.com/scbt/product/doxazosin-mesylate-77883-43-3 |
| Melting Point | 276.0 | ℃ | 275-277 | ℃ | https://www.chemicalbook.com/ChemicalProductProperty_EN_CB3285710.htm |
| Water Solubility | 0.8 | % | 0.8 | % | https://www.accessdata.fda.gov/drugsatfda_docs/label/2009/019668s021lbl.pdf |
| pKa | 6.52 | - | 6.52 | - | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL707/ |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 65.0 | % | 60-70 | % | DRUGBANK | |
| T Max | 2.5 | h | 2-3 | h | DRUGBANK | |
| Clearance | 0.0900 | L/h/kg | ~1-2 | ml/min/kg | DRUGBANK | Clearance | 0.0960 | L/h/kg | 1.6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 1.5 | L/kg | 1.0-1.9 | L/kg | DRUGBANK | Volume of Distribution | 1.3 | L/kg | 1.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 10.5 | h | 9-12 | h | elimination half-life; different study; | DRUGBANK | Half-life | 22.0 | h | 22 | h | elimination half-life; | DRUGBANK | Half-life | 10.0 | h | 10 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 1000.0 | mg/kg | >1000 | mg/kg | PO, oral; mouse; | DRUGBANK |
| Eliminate Route | 63.0 | % | 63 | % | Faeces excretion; PO, oral; intravenous injection, IV; | DRUGBANK | Eliminate Route | 9.0 | % | ~9 | % | Urinary excretion; PO, oral; intravenous injection, IV; | DRUGBANK | Eliminate Route | 5.0 | % | ~5 | % | Faeces excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 98.0 | % | ~98 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 16.0 | mg/day | 16 | mg/day | PO, oral | Cardura | doxazosin mesylate | PDR |
| Max dose for adults | 8.0 | mg/day | 8 | mg/day | PO, oral | Cardura | doxazosin mesylate | PDR |
| Max dose for elderly | 16.0 | mg/day | 16 | mg/day | PO, oral | Cardura | doxazosin mesylate | PDR |
| Max dose for elderly | 8.0 | mg/day | 8 | mg/day | PO, oral | Cardura | doxazosin mesylate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1