Basic Information
| Drug ID | DDPD00530 |
|
| Drug Name | Erlotinib | |
| Molecular Weight | 393.4357 | |
| Molecular Formula | C22H23N3O4 | |
| CAS Number | 183321-74-6 | |
| SMILES | COCCOC1=CC2=C(C=C1OCCOC)C(NC1=CC(=CC=C1)C#C)=NC=N2 | |
| External Links | ||
| DRUGBANK | DB00530 | |
| PubChem Compound | 176870 | |
| PDR | 2076 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.7 | - | 2.7 | - | DRUGBANK |
| Water Solubility | 400.0 | mg/L | 0.4 | mg/ml | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Absorption | 60.0 | % | 60 | % | PO, oral; | DRUGBANK | |
| Bioavailability | 100.0 | % | 100 | % | PO, oral; food; | food ↑ ; | DRUGBANK |
| T Max | 4.0 | h | 4 | h | PO, oral; | DRUGBANK | |
| Clearance | 0.10 | L/h/kg | 1.69 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 232.0 | L | 232.0 | L | Apparent volume of distribution; | DRUGBANK | Volume of Distribution | 0.77 | L/kg | 0.77 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 36.2 | h | 36.2 | h | DRUGBANK | Half-life | 6.5 | h | 6.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 83.0 | % | 83 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 8.0 | % | 8 | % | Urinary excretion; PO, oral; | DRUGBANK | Eliminate Route | 1.0 | % | 1 | % | Faeces excretion; PO, oral; Unchanged drug; | DRUGBANK | Eliminate Route | 0.30 | % | 0.3 | % | Urinary excretion; PO, oral; Unchanged drug; | DRUGBANK |
| Protein Binding | 93.0 | % | 93 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 150.0 | mg/day | 150 | mg/day | PO, oral | Tarceva | erlotinib | PDR |
| Max dose for adults | 100.0 | mg/day | 100 | mg/day | PO, oral | Tarceva | erlotinib | PDR |
| Max dose for geriatric | 150.0 | mg/day | 150 | mg/day | PO, oral | Tarceva | erlotinib | PDR |
| Max dose for geriatric | 100.0 | mg/day | 100 | mg/day | PO, oral | Tarceva | erlotinib | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1