Basic Information
| Drug ID | DDPD00496 |
|
| Drug Name | Darifenacin | |
| Molecular Weight | 426.55 | |
| Molecular Formula | C28H30N2O2 | |
| CAS Number | 133099-04-4 | |
| SMILES | NC(=O)C([C@@H]1CCN(CCC2=CC3=C(OCC3)C=C2)C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB00496 | |
| T3DB | T3D3499 | |
| PubChem Compound | 444031 | |
| PDR | 2271 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.5 | - | 4.5 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 15.0 | % | 15.0 | % | Capsule, PO, Oral; | DRUGBANK | Bioavailability | 19.0 | % | 19.0 | % | Capsule, PO, Oral; | DRUGBANK |
| Clearance | 40.0 | L/h | 40.0 | L/h | extensive metabolizers, EM; | DRUGBANK | Clearance | 32.0 | L/h | 32.0 | L/h | poor metabolizers, PM; | DRUGBANK | Clearance | 0.72 | L/h/kg | 12 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 163.0 | L | 163.0 | L | DRUGBANK | Volume of Distribution | 2.6 | L/kg | 2.6 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 16.0 | h | ~13-19 | h | elimination half-life; inhalation, IH; | DRUGBANK | Half-life | 3.6 | h | 3.6 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 98.0 | % | ~98 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 15.0 | mg/day | 15 | mg/day | PO, oral | Enablex | darifenacin | PDR |
| Max dose for geriatric | 15.0 | mg/day | 15 | mg/day | PO, oral | Enablex | darifenacin | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1