Basic Information
| Drug ID | DDPD00491 |
|
| Drug Name | Miglitol | |
| Molecular Weight | 207.2243 | |
| Molecular Formula | C8H17NO5 | |
| CAS Number | 72432-03-2 | |
| SMILES | OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | |
| External Links | ||
| DRUGBANK | DB00491 | |
| PubChem Compound | 441314 | |
| PDR | 1872 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -2.7 | - | -2.7 | - | DRUGBANK |
| Melting Point | 114.0 | ℃ | 114 | ℃ | DRUGBANK |
| pKa | 5.9 | - | 5.9 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | 100.0 | % | PO, oral; | DRUGBANK | Absorption | 60.0 | % | 50-70 | % | PO, oral; | DRUGBANK |
| Metabolic | 0 | % | 0 | % | human, homo sapiens; animals; | DRUGBANK |
| Clearance | 0.10 | L/h/kg | 1.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.18 | L/kg | 0.18 | L/kg | DRUGBANK | Volume of Distribution | 0.28 | L/kg | 0.28 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.0 | h | ~2 | h | elimination half-life; | DRUGBANK | Half-life | 2.3 | h | 2.3 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 4.0 | % | 4 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 300.0 | mg/day | 300 | mg/day | PO, oral | Glyset | miglitol | PDR |
| Max dose for geriatric | 300.0 | mg/day | 300 | mg/day | PO, oral | Glyset | miglitol | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1