| Drug ID | DDPD00443 |
|
| Drug Name | Betamethasone | |
| Molecular Weight | 392.4611 | |
| Molecular Formula | C22H29FO5 | |
| CAS Number | 378-44-9 | |
| SMILES | [H][C@@]12C[C@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C | |
| External Links | ||
| DRUGBANK | DB00443 | |
| PubChem Compound | 9782 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.138 | - | 1.138 | - | http://www.chemspider.com/Chemical-Structure.9399.html |
| Boiling Point | 568.2 | ℃ | 568.2 | ℃ | http://www.chemspider.com/Chemical-Structure.9399.html |
| Melting Point | 178.0 | ℃ | 178 | ℃ | http://www.chemspider.com/Chemical-Structure.20490.html |
| Water Solubility | 66.5 | mg/L | 66.5 | mg/L | EPA |
| Log S | -3.77 | - | -3.77 | - | ADME Research, USCD |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 6.5 | L/h | 6466±805 | ml/h | Total clearance; IM,intramuscular injection; Female, women; young; | DRUGBANK | Clearance | 0.17 | L/h/kg | 2.8 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 94.6 | L | 94584±23539 | mL | IM,intramuscular injection; Single dose; Female, women; | DRUGBANK | Volume of Distribution | 1.3 | L/kg | 1.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 10.2 | h | 10.2±2.5 | h | Asian; Female, women; | DRUGBANK | Half-life | 5.6 | h | 5.6 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
Not Available