Basic Information
| Drug ID | DDPD00432 |
|
| Drug Name | Trifluridine | |
| Molecular Weight | 296.1999 | |
| Molecular Formula | C10H11F3N2O5 | |
| CAS Number | 70-00-8 | |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(C(=O)NC1=O)C(F)(F)F | |
| External Links | ||
| DRUGBANK | DB00432 | |
| PubChem Compound | 6256 | |
| PDR | 1497 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -0.46 | - | -0.46 | - | HANSCH,C ET AL. (1995) |
| Melting Point | 187.5 | ℃ | 186-189 | ℃ | PhysProp |
| pKa | 7.95 | - | 7.95 | - | SANGSTER (1994) |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 57.0 | % | >57 | % | PO, oral; | DRUGBANK |
| T Max | 2.0 | h | 2 | h | PO, oral; | DRUGBANK |
| Clearance | 10.5 | L/h | 10.5 | L/h | Total clearance; PO, oral; tumor; patients; | DRUGBANK |
| Volume of Distribution | 21.0 | L | 21.0 | L | Apparent volume of distribution; tumor; patients; | DRUGBANK |
| Half-life | 0.25 | h | 12-18 | min | intravenous infusion, IV in drop; | DRUGBANK | Half-life | 1.4 | h | 1.4 | h | elimination half-life; Oral single dose; | DRUGBANK | Half-life | 2.1 | h | 2.1 | h | elimination half-life; | DRUGBANK |
| Toxicity LD50 | 2946.0 | mg/kg | 2946.0 | mg/kg | intravenous injection, IV; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 4379.0 | mg/kg | >4379 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 55.0 | % | ~55 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 1.5 | % | 1.5 | % | Urinary excretion; Oral single dose; Unchanged drug; | DRUGBANK |
| Protein Binding | 96.0 | % | >96 | % | plasma proteins; high protein binding; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 9.0 | drop/day | 9 | drop/day | ophthalmic administration | Viroptic | trifluridine | PDR |
| Max dose for adolescents | 9.0 | drop/day | 9 | drop/day | ophthalmic administration | Viroptic | trifluridine | PDR |
| Max dose for adults | 9.0 | drop/day | 9 | drop/day | ophthalmic administration | Viroptic | trifluridine | PDR |
| Max dose for elderly | 9.0 | drop/day | 9 | drop/day | ophthalmic administration | Viroptic | trifluridine | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1