Basic Information
| Drug ID | DDPD00394 |
|
| Drug Name | Beclomethasone dipropionate | |
| Molecular Weight | 521.042 | |
| Molecular Formula | C28H37ClO7 | |
| CAS Number | 5534-09-8 | |
| SMILES | [H][C@@]12C[C@H](C)[C@](OC(=O)CC)(C(=O)COC(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1(Cl)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C | |
| External Links | ||
| DRUGBANK | DB00394 | |
| PubChem Compound | 21700 | |
| PDR | 177 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 3.49 | - | 3.49 | - | MSDS |
| Melting Point | 209.0 | ℃ | 208-210 | ℃ | MSDS |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 6.7 | ng.h/ml | 6660.0 | pg.h/ml | PO, oral; different study; | DRUGBANK | AUC | 6.2 | ng.h/ml | 6185.0 | pg.h/ml | different study; Active metabolite; | DRUGBANK | AUC | 10.2 | ng.h/ml | 10158.0 | pg.h/ml | PO, oral; different study; Active metabolite; | DRUGBANK | AUC | 3.7 | ng.h/ml | 3660.0 | pg.h/ml | inhalation, IH; different study; Active metabolite; | DRUGBANK |
| Bioavailability | 41.0 | % | 41.0 | % | PO, oral; different study; Active metabolite; | DRUGBANK | Bioavailability | 44.0 | % | 44.0 | % | inhalation, IH; different study; Active metabolite; | DRUGBANK |
| C Max | 0.0880 | ng/ml | 88.0 | pg/ml | PO, oral; | DRUGBANK | C Max | 35.4 | ng/ml | 35356.0 | pg/ml | PO, oral; different study; | DRUGBANK | C Max | 1.4 | ng/ml | 1419.0 | pg/ml | Active metabolite; | DRUGBANK | C Max | 2.6 | ng/ml | 2633.0 | pg/ml | different study; Active metabolite; | DRUGBANK | C Max | 0.70 | ng/ml | 703.0 | pg/ml | PO, oral; different study; Active metabolite; | DRUGBANK | C Max | 0.31 | ng/ml | 310.0 | pg/ml | inhalation, IH; different study; Active metabolite; | DRUGBANK |
| T Max | 0.50 | h | 0.5 | h | PO, oral; | DRUGBANK | T Max | 0.20 | h | 0.2 | h | PO, oral; different study; | DRUGBANK | T Max | 0.70 | h | 0.7 | h | Active metabolite; | DRUGBANK | T Max | 0.20 | h | 0.2 | h | different study; Active metabolite; | DRUGBANK | T Max | 4.0 | h | 4 | h | PO, oral; different study; Active metabolite; | DRUGBANK |
| Clearance | 150.0 | L/h | 150.0 | L/h | DRUGBANK | Clearance | 120.0 | L/h | 120.0 | L/h | DRUGBANK | Clearance | 2.2 | L/h/kg | 36 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 20.0 | L | 20.0 | L | Steady state volume of distribution; intravenous injection, IV; | DRUGBANK | Volume of Distribution | 424.0 | L | 424.0 | L | Steady state volume of distribution; intravenous injection, IV; | DRUGBANK | Volume of Distribution | 0.29 | L/kg | 0.29 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 0.50 | h | 0.5 | h | intravenous injection, IV; | DRUGBANK | Half-life | 2.7 | h | 2.7 | h | DRUGBANK | Half-life | 8.8 | h | 8.8 | h | PO, oral; | DRUGBANK | Half-life | 5.7 | h | 5.7 | h | intranasal; | DRUGBANK | Half-life | 0.50 | h | 0.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 3750.0 | mg/kg | 3750.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 10.0 | % | <10 | % | Urinary excretion; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 0.64 | mg/day | 640 | mcg/day | inhalation, IH | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for children | 0.336 | mg/day | 336 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for children | 0.32 | mg/day | 320 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for children | 0.16 | mg/day | 160 | mcg/day | inhalation, IH | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for children | 0.336 | mg/day | 336 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for children | 0.08 | mg/day | 80 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for children | 0.16 | mg/day | 160 | mcg/day | inhalation, IH | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for children | 0.08 | mg/day | 80 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for adolescents | 0.64 | mg/day | 640 | mcg/day | inhalation, IH | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for adolescents | 0.336 | mg/day | 336 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for adolescents | 0.32 | mg/day | 320 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for adults | 0.64 | mg/day | 640 | mcg/day | inhalation, IH | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for adults | 0.336 | mg/day | 336 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for adults | 0.32 | mg/day | 320 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for geriatric | 0.64 | mg/day | 640 | mcg/day | inhalation, IH | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for geriatric | 0.336 | mg/day | 336 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
| Max dose for geriatric | 0.32 | mg/day | 320 | mcg/day | nasal spray | Beconase AQ | beclomethasone dipropionate monohydrate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1