Basic Information
| Drug ID | DDPD00380 |
|
| Drug Name | Dexrazoxane | |
| Molecular Weight | 268.2691 | |
| Molecular Formula | C11H16N4O4 | |
| CAS Number | 24584-09-6 | |
| SMILES | C[C@@H](CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 | |
| External Links | ||
| DRUGBANK | DB00380 | |
| T3DB | T3D2771 | |
| PubChem Compound | 71384 | |
| PDR | 1884 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -2.6 | - | -2.6 | - | DRUGBANK |
| Melting Point | 194.0 | ℃ | 191-197 | ℃ | DRUGBANK |
| pKa | 2.1 | - | 2.1 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 100.0 | % | 100.0 | % | intravenous injection, IV; | DRUGBANK |
| Clearance | 7.9 | L/h/m2 | 7.88 | L/h/m2 | DRUGBANK | |
| Clearance | 6.3 | L/h/m2 | 6.25 | L/h/m2 | DRUGBANK | |
| Clearance | 0.19 | L/h/kg | 3.1 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 15.8 | L/m2 | 9-22.6 | L/m2 | DRUGBANK | |
| Volume of Distribution | 0.55 | L/kg | 0.55 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.5 | h | 2.5 | h | DRUGBANK | |
| Half-life | 2.5 | h | 2.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 500.0 | mg/kg | 500.0 | mg/kg | Intraperitoneal, IP; mouse; | DRUGBANK |
| Toxicity LD50 | 2000.0 | mg/kg | 2.0 | g/kg | intravenous injection, IV; dog; | DRUGBANK |
| Toxicity LD50 | 500.0 | mg/kg | 500.0 | mg/kg | Intraperitoneal, IP; mouse; | T3DB |
| Toxicity LD50 | 2000.0 | mg/kg | 2.0 | g/kg | intravenous injection, IV; dog; | T3DB |
| Eliminate Route | 42.0 | % | 42 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 2.0 | % | <2 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 1000.0 | mg/m2 | 1000 | mg/m2 | Zinecard | dexrazoxane | PDR | |
| Max dose for adults | 2000.0 | mg | 2000 | mg | Zinecard | dexrazoxane | PDR | |
| Max dose for geriatric | 1000.0 | mg/m2 | 1000 | mg/m2 | Zinecard | dexrazoxane | PDR | |
| Max dose for geriatric | 2000.0 | mg | 2000 | mg | Zinecard | dexrazoxane | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1