Basic Information
| Drug ID | DDPD00377 |
|
| Drug Name | Palonosetron | |
| Molecular Weight | 296.414 | |
| Molecular Formula | C19H24N2O | |
| CAS Number | 135729-56-5 | |
| SMILES | [H][C@]12CCCC3=C1C(=CC=C3)C(=O)N(C2)[C@@H]1CN2CCC1CC2 | |
| External Links | ||
| DRUGBANK | DB00377 | |
| PubChem Compound | 6337614 | |
| PDR | 137 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.7 | - | 2.7 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Metabolic | 50.0 | % | 50 | % | Liver metabolism; | DRUGBANK |
| Clearance | 0.16 | L/h/kg | 160±35 | ml/h/kg | DRUGBANK | Clearance | 0.16 | L/h/kg | 2.6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 8.3 | L/kg | 8.3 ± 2.5 | L/kg | DRUGBANK | Volume of Distribution | 6.3 | L/kg | 6.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 40.0 | h | ~40 | h | DRUGBANK | Half-life | 39.0 | h | 39 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity Lethal Dose | 30.0 | mg/kg | 30.0 | mg/kg | mouse; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 8.0 | % | ~8 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 62.0 | % | 62 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 0.02 | mg/kg/dose | 20 | mcg/kg/dose | intravenous injection, IV | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for children | 1.5 | mg/dose | 1.5 | mg/dose | intravenous injection, IV | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for children | 0.02 | mg/kg/dose | 20 | mcg/kg/dose | intravenous injection, IV | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for adolescents | 1.5 | mg/dose | 1.5 | mg/dose | intravenous injection, IV | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for adolescents | 0.02 | mg/kg/dose | 20 | mcg/kg/dose | intravenous injection, IV | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for adults | 0.25 | mg/dose | 0.25 | mg/dose | intravenous injection, IV | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for adults | 0.5 | mg/dose | 0.5 | mg/dose | PO, oral | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for geriatric | 0.25 | mg/dose | 0.25 | mg/dose | intravenous injection, IV | Aloxi | palonosetron hydrochloride | PDR |
| Max dose for geriatric | 0.5 | mg/dose | 0.5 | mg/dose | PO, oral | Aloxi | palonosetron hydrochloride | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1