Basic Information
| Drug ID | DDPD00362 |
|
| Drug Name | Anidulafungin | |
| Molecular Weight | 1140.2369 | |
| Molecular Formula | C58H73N7O17 | |
| CAS Number | 166663-25-8 | |
| SMILES | [H][C@]1(NC(=O)[C@@H](NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)[C@H](C[C@@H](O)[C@@H](O)NC(=O)[C@@H]2[C@@H](O)[C@@H](C)CN2C1=O)NC(=O)C1=CC=C(C=C1)C1=CC=C(C=C1)C1=CC=C(OCCCCC)C=C1)[C@@H](C)O)[C@H](O)[C@@H](O)C1=CC=C(O)C=C1)[C@@H](C)O | |
| External Links | ||
| DRUGBANK | DB00362 | |
| T3DB | T3D2763 | |
| PubChem Compound | 166548 | |
| PDR | 1816 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.9 | - | 2.9 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 1.0 | L/h | 1.0 | L/h | DRUGBANK | Clearance | 0.0126 | L/h/kg | 0.21 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 40.0 | L | 30-50 | L | DRUGBANK | Volume of Distribution | 0.57 | L/kg | 0.57 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 45.0 | h | 40-50 | h | DRUGBANK | Half-life | 40.0 | h | 40 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 84.0 | % | 84 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 3.0 | mg/kg | 3 | mg/kg | intravenous injection, IV | Eraxis | anidulafungin | PDR |
| Max dose for children | 200.0 | mg/dose | 200 | mg/dose | intravenous injection, IV | Eraxis | anidulafungin | PDR |
| Max dose for adolescents | 200.0 | mg/day | 200 | mg/day | intravenous injection, IV | Eraxis | anidulafungin | PDR |
| Max dose for adolescents | 3.0 | mg/kg | 3 | mg/kg | intravenous injection, IV | Eraxis | anidulafungin | PDR |
| Max dose for adolescents | 200.0 | mg/dose | 200 | mg/dose | intravenous injection, IV | Eraxis | anidulafungin | PDR |
| Max dose for adults | 200.0 | mg/day | 200 | mg/day | intravenous injection, IV | Eraxis | anidulafungin | PDR |
| Max dose for geriatric | 200.0 | mg/day | 200 | mg/day | intravenous injection, IV | Eraxis | anidulafungin | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1