Basic Information
| Drug ID | DDPD00323 |
|
| Drug Name | Tolcapone | |
| Molecular Weight | 273.2408 | |
| Molecular Formula | C14H11NO5 | |
| CAS Number | 134308-13-7 | |
| SMILES | CC1=CC=C(C=C1)C(=O)C1=CC(=C(O)C(O)=C1)[N+]([O-])=O | |
| External Links | ||
| DRUGBANK | DB00323 | |
| T3DB | T3D2751 | |
| PubChem Compound | 4659569 | |
| PDR | 1605 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.0 | - | 4.0 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 65.0 | % | 65.0 | % | DRUGBANK | |
| Clearance | 7.0 | L/h | 7.0 | L/h | DRUGBANK | Clearance | 0.11 | L/h/kg | 1.9 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 9.0 | L | 9.0 | L | DRUGBANK | Volume of Distribution | 0.12 | L/kg | 0.12 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.8 | h | 2-3.5 | h | DRUGBANK | Half-life | 1.1 | h | 1.1 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 1600.0 | mg/kg | 1600.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 1600.0 | mg/kg | 1600.0 | mg/kg | PO, oral; Rattus, Rat; | T3DB |
| Eliminate Route | 0.50 | % | 0.5 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.9 | % | >99.9 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 600.0 | mg/day | 600 | mg/day | PO, oral | Tasmar | tolcapone | PDR |
| Max dose for geriatric | 600.0 | mg/day | 600 | mg/day | PO, oral | Tasmar | tolcapone | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1