Basic Information
| Drug ID | DDPD00303 |
|
| Drug Name | Ertapenem | |
| Molecular Weight | 475.515 | |
| Molecular Formula | C22H25N3O7S | |
| CAS Number | 153832-46-3 | |
| SMILES | [H][C@]12[C@@H](C)C(S[C@]3([H])CN[C@@]([H])(C3)C(=O)NC3=CC=CC(=C3)C(O)=O)=C(N1C(=O)[C@]2([H])[C@@H](C)O)C(O)=O | |
| External Links | ||
| DRUGBANK | DB00303 | |
| PubChem Compound | 150610 | |
| PDR | 359 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 0.3 | - | 0.3 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | ~100 | % | IM,intramuscular injection; | DRUGBANK |
| Bioavailability | 92.0 | % | 92.0 | % | IM,intramuscular injection; | DRUGBANK | Bioavailability | 77.0 | % | 77.0 | % | IM,intramuscular injection; Male, men; | DRUGBANK |
| Clearance | 1.8 | L/h | 1.8 | L/h | DRUGBANK | Clearance | 0.0270 | L/h/kg | 0.45 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.12 | L/kg | 0.12 | L/kg | adults; | DRUGBANK | Volume of Distribution | 0.18 | L/kg | 0.16-0.2 | L/kg | pediatric patients; | DRUGBANK | Volume of Distribution | 0.12 | L/kg | 0.12 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 4.0 | h | ~4 | h | elimination half-life; | DRUGBANK | Half-life | 3.8 | h | 3.8 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 80.0 | % | 80 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 38.0 | % | ~38 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 95.0 | % | ~95 | % | DRUGBANK | Protein Binding | 85.0 | % | ~85 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 30.0 | mg/kg/day | 30 | mg/kg/day | intravenous injection, IV;IM,intramuscular injection; | Invanz | ertapenem | PDR |
| Max dose for infants | 1.0 | g/day | 1 | g/day | intravenous injection, IV;IM,intramuscular injection; | Invanz | ertapenem | PDR |
| Max dose for children | 30.0 | mg/kg/day | 30 | mg/kg/day | intravenous injection, IV;IM,intramuscular injection; | Invanz | ertapenem | PDR |
| Max dose for children | 1000.0 | mg/day | 1 | g/day | intravenous injection, IV;IM,intramuscular injection; | Invanz | ertapenem | PDR |
| Max dose for adolescents | 1000.0 | mg/day | 1 | g/day | intravenous injection, IV;IM,intramuscular injection; | Invanz | ertapenem | PDR |
| Max dose for adults | 1000.0 | mg/day | 1 | g/day | intravenous injection, IV;IM,intramuscular injection; | Invanz | ertapenem | PDR |
| Max dose for elderly | 1000.0 | mg/day | 1 | g/day | intravenous injection, IV;IM,intramuscular injection; | Invanz | ertapenem | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1