Basic Information
| Drug ID | DDPD00302 |
|
| Drug Name | Tranexamic acid | |
| Molecular Weight | 157.2102 | |
| Molecular Formula | C8H15NO2 | |
| CAS Number | 1197-18-8 | |
| SMILES | NC[C@H]1CC[C@@H](CC1)C(O)=O | |
| External Links | ||
| DRUGBANK | DB00302 | |
| PubChem Compound | 5526 | |
| PDR | 1247 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 0.3 | - | 0.3 | - | DRUGBANK |
| Melting Point | 300.0 | ℃ | >300 | ℃ | PhysProp |
| Water Solubility | 167000.0 | mg/L | 167000 | mg/L | MERCK INDEX 1996) |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 40.0 | % | 30-50 | % | PO, oral; | DRUGBANK |
| Metabolic | 5.0 | % | <5 | % | DRUGBANK | |
| Clearance | 6.8 | L/h | 110-116 | ml/min | DRUGBANK | Clearance | 0.14 | L/h/kg | 2.4 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 10.5 | L | 9-12.0 | L | DRUGBANK | Volume of Distribution | 0.38 | L/kg | 0.38 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 3.0 | h | 3 | h | elimination half-life; | DRUGBANK | Half-life | 2.3 | h | 2.3 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 10000.0 | mg/kg | 10.0 | g/kg | PO, oral; mouse; | DRUGBANK |
| Protein Binding | 3.0 | % | ~3 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 3900.0 | mg/day | 3900 | mg/day | PO, oral | Lysteda | tranexamic acid | PDR |
| Max dose for children | 40.0 | mg/kg/day | 40 | mg/kg/day | intravenous injection, IV | Lysteda | tranexamic acid | PDR |
| Max dose for children | 40.0 | mg/kg/day | 40 | mg/kg/day | intravenous injection, IV | Lysteda | tranexamic acid | PDR |
| Max dose for adolescents | 3900.0 | mg/day | 3900 | mg/day | PO, oral | Lysteda | tranexamic acid | PDR |
| Max dose for adolescents | 40.0 | mg/kg/day | 40 | mg/kg/day | intravenous injection, IV | Lysteda | tranexamic acid | PDR |
| Max dose for adults | 3900.0 | mg/day | 3900 | mg/day | PO, oral | Lysteda | tranexamic acid | PDR |
| Max dose for adults | 40.0 | mg/kg/day | 40 | mg/kg/day | intravenous injection, IV | Lysteda | tranexamic acid | PDR |
| Max dose for geriatric | 3900.0 | mg/day | 3900 | mg/day | PO, oral | Lysteda | tranexamic acid | PDR |
| Max dose for geriatric | 40.0 | mg/kg/day | 40 | mg/kg/day | intravenous injection, IV | Lysteda | tranexamic acid | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1