Basic Information
| Drug ID | DDPD00286 |
|
| Drug Name | Conjugated estrogens | |
| Molecular Weight | N.A. | |
| Molecular Formula | N.A. | |
| CAS Number | 12126-59-9 | |
| SMILES | CC12CCC3C(C1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] | |
| External Links | ||
| DRUGBANK | DB00286 | |
| PubChem Compound | 45357473 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 3.7 | - | 3.7 | - | Hsieh R. et al. 2007. Steroids. |
| Melting Point | 227.5 | ℃ | 173-282 | ℃ | Report on carcinogens. 12th edition. NIH. |
| pKa | 10.0 | - | 10 | - | Hurwitz AR. and Liu ST. J Pharm Sci. 1977. (based on the average of different estrogens) |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 35.0 | ng.h/ml | 35.0 | ng.h/ml | Oral multiple dose; | DRUGBANK |
| C Max | 2.6 | ng/ml | 2.6 | ng/ml | Oral multiple dose; | DRUGBANK |
| T Max | 7.0 | h | 7 | h | PO, oral; | DRUGBANK |
| Clearance | 615.0 | L/m2 | ~615 | L/m2 | DRUGBANK | |
| Half-life | 17.0 | h | 17 | h | DRUGBANK | |
| Toxicity LD50 | 5000.0 | mg/kg | >5000 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Protein Binding | 65.0 | % | ~50-80 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1