Basic Information
| Drug ID | DDPD00245 |
|
| Drug Name | Benzatropine | |
| Molecular Weight | 307.4293 | |
| Molecular Formula | C21H25NO | |
| CAS Number | 86-13-5 | |
| SMILES | [H][C@]12CC[C@]([H])(C[C@@]([H])(C1)OC(C1=CC=CC=C1)C1=CC=CC=C1)N2C | |
| External Links | ||
| DRUGBANK | DB00245 | |
| T3DB | T3D2724 | |
| PubChem Compound | 1201549 | |
| PDR | 1940 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.27 | - | 4.27 | - | Xu A. and Madden T. 2012. LC-MS in Drug Bioanalysis. |
| Boiling Point | 547.8 | ℃ | 547.8 | ℃ | CAS |
| Melting Point | 135.0 | ℃ | 135 | ℃ | 'MSDS' |
| Water Solubility | 81000.0 | mg/L | 81 | mg/ml | 'MSDS' |
| pKa | 10.0 | - | 10 | - | Troy D. and Beringer P. 2006. Remington: The Science and Practice of Pharmacy. |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 29.0 | % | 29.0 | % | PO, oral; | DRUGBANK |
| C Max | 2.5 | ng/ml | 2.5 | ng/ml | PO, oral; | DRUGBANK |
| T Max | 7.0 | h | 7 | h | PO, oral; | DRUGBANK |
| Volume of Distribution | 21.0 | L/kg | 12.0-30 | L/kg | DRUGBANK | |
| Half-life | 36.0 | h | ~36 | h | elimination half-life; | DRUGBANK |
| Toxicity LD50 | 940.0 | mg/kg | 940.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Protein Binding | 95.0 | % | 95 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 0.0 | 0 | Benztropine Mesylate | benztropine mesylate | PDR | |||
| Max dose for children | 0.05 | mg/kg/dose | 0.05 | mg/kg/dose | PO, oral;IM,intramuscular injection;intravenous injection, IV; | Benztropine Mesylate | benztropine mesylate | PDR |
| Max dose for children | 1.0 | mg/dose | 1 | mg/dose | PO, oral;IM,intramuscular injection;intravenous injection, IV; | Benztropine Mesylate | benztropine mesylate | PDR |
| Max dose for adolescents | 0.05 | mg/kg/dose | 0.05 | mg/kg/dose | PO, oral;IM,intramuscular injection;intravenous injection, IV; | Benztropine Mesylate | benztropine mesylate | PDR |
| Max dose for adolescents | 8.0 | mg/day | 8 | mg/day | PO, oral;IM,intramuscular injection;intravenous injection, IV; | Benztropine Mesylate | benztropine mesylate | PDR |
| Max dose for adults | 8.0 | mg/day | 8 | mg/day | PO, oral;IM,intramuscular injection;intravenous injection, IV; | Benztropine Mesylate | benztropine mesylate | PDR |
| Max dose for geriatric | 8.0 | mg/day | 8 | mg/day | PO, oral;IM,intramuscular injection;intravenous injection, IV; | Benztropine Mesylate | benztropine mesylate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1