Basic Information
| Drug ID | DDPD00243 |
|
| Drug Name | Ranolazine | |
| Molecular Weight | 427.5365 | |
| Molecular Formula | C24H33N3O4 | |
| CAS Number | 95635-55-5 | |
| SMILES | COC1=CC=CC=C1OCC(O)CN1CCN(CC(=O)NC2=C(C)C=CC=C2C)CC1 | |
| External Links | ||
| DRUGBANK | DB00243 | |
| PubChem Compound | 56959 | |
| PDR | 163 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.07 | - | 2.07 | - | Australian Assessment Report |
| Boiling Point | 624.1 | ℃ | 624.1 | ℃ | https://pubchem.ncbi.nlm.nih.gov/compound/Ranolazine |
| Melting Point | 122.0 | ℃ | 120-124 | ℃ | https://s3-us-west-2.amazonaws.com/drugbank/msds/DB00243.pdf?1550621114 |
| Water Solubility | 1000.0 | mg/L | <1 | mg/ml | MSDS |
| pKa | 2.2 | - | 2.2 | - | Australian Assessment Report |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 76.0 | % | 76.0 | % | Tablet, PO, oral; | DRUGBANK |
| Css | 2600.0 | ng/ml | 2600.0 | ng/ml | DRUGBANK | |
| T Max | 4.0 | h | 3-5 | h | DRUGBANK | |
| Tss | 72.0 | h | <3 | day | DRUGBANK | |
| Clearance | 45.0 | L/h | 45.0 | L/h | Oral multiple dose; | DRUGBANK | Clearance | 0.57 | L/h/kg | 9.5 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 53.2 | L | 53.2 | L | Apparent volume of distribution; | DRUGBANK | Volume of Distribution | 132.5 | L | 85-180 | L | Steady state volume of distribution; | DRUGBANK | Volume of Distribution | 1.2 | L/kg | 1.2 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 7.0 | h | 7 | h | terminal half-life; | DRUGBANK | Half-life | 1.8 | h | 1.8 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 980.0 | mg/kg | 980.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 75.0 | % | ~75 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 25.0 | % | ~25 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 5.0 | % | ~5 | % | Unchanged drug; | DRUGBANK |
| Protein Binding | 62.0 | % | ~62 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 2000.0 | mg/day | 2000 | mg/day | PO, oral | Ranexa | ranolazine | PDR |
| Max dose for elderly | 2000.0 | mg/day | 2000 | mg/day | PO, oral | Ranexa | ranolazine | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1