Basic Information
| Drug ID | DDPD00235 |
|
| Drug Name | Milrinone | |
| Molecular Weight | 211.2194 | |
| Molecular Formula | C12H9N3O | |
| CAS Number | 78415-72-2 | |
| SMILES | CC1=C(C=C(C#N)C(=O)N1)C1=CC=NC=C1 | |
| External Links | ||
| DRUGBANK | DB00235 | |
| PubChem Compound | 4197 | |
| PDR | 1147 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 0.4 | - | 0.4 | - | DRUGBANK |
| Melting Point | 300.0 | ℃ | >300 | ℃ | PhysProp |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | ~100 | % | PO, oral; normal,healthy; | DRUGBANK |
| Bioavailability | 92.0 | % | 92.0 | % | PO, oral; normal,healthy; | DRUGBANK |
| Clearance | 0.13 | L/h/kg | 0.13 | L/kg/h | intravenous injection, IV; heart disease; patients; | DRUGBANK | Clearance | 0.14 | L/h/kg | 0.14 | L/kg/h | intravenous injection, IV; heart disease; patients; | DRUGBANK | Clearance | 0.37 | L/h/kg | 6.2 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.38 | L | 0.38 | L | intravenous injection, IV; heart disease; | DRUGBANK | Volume of Distribution | 0.45 | L | 0.45 | L | intravenous injection, IV; heart disease; | DRUGBANK | Volume of Distribution | 0.25 | L/kg | 0.25 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.3 | h | 2.3 | h | DRUGBANK | Half-life | 0.80 | h | 0.8 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 0.30 | mg/L | 0.3 | mg/L | Rattus, Rat; | DRUGBANK |
| Protein Binding | 75.0 | % | 70-80 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for neonates | 1.08 | mg/kg/day | 0.75 | mcg/kg/minute | intravenous infusion, iv in drop | Milrinone Lactate | milrinone lactate | PDR |
| Max dose for infants | 1.08 | mg/kg/day | 0.75 | mcg/kg/min | intravenous infusion, iv in drop | Milrinone Lactate | milrinone lactate | PDR |
| Max dose for children | 1.08 | mg/kg/day | 0.75 | mcg/kg/minute | intravenous infusion, iv in drop | Milrinone Lactate | milrinone lactate | PDR |
| Max dose for adolescents | 1.08 | mg/kg/day | 0.75 | mcg/kg/minute | intravenous infusion, iv in drop | Milrinone Lactate | milrinone lactate | PDR |
| Max dose for adults | 1.08 | mg/kg/day | 0.75 | mcg/kg/min | intravenous infusion, iv in drop | Milrinone Lactate | milrinone lactate | PDR |
| Max dose for geriatric | 1.08 | mg/kg/day | 0.75 | mcg/kg/minute | intravenous infusion, iv in drop | Milrinone Lactate | milrinone lactate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1