| Drug ID | DDPD00231 |
|
| Drug Name | Temazepam | |
| Molecular Weight | 300.74 | |
| Molecular Formula | C16H13ClN2O2 | |
| CAS Number | 846-50-4 | |
| SMILES | CN1C2=C(C=C(Cl)C=C2)C(=NC(O)C1=O)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB00231 | |
| T3DB | T3D2719 | |
| PubChem Compound | 5391 | |
| PDR | 793 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.19 | - | 2.19 | - | HANSCH,C ET AL. (1995) |
| Melting Point | 120.0 | ℃ | 119-121 | ℃ | PhysProp |
| Water Solubility | 164.0 | mg/L | 164 | mg/L | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 95.0 | % | 90-100 | % | PO, oral; | DRUGBANK |
| C Max | 824.0 | ng/ml | 666-982 | ng/ml | DRUGBANK | C Max | 865.0 | ng/ml | 865.0 | ng/ml | DRUGBANK |
| T Max | 2.5 | h | 2-3 | h | PO, oral; | DRUGBANK | T Max | 1.4 | h | 1.2-1.6 | h | DRUGBANK | T Max | 1.5 | h | 1.5 | h | DRUGBANK |
| Metabolic | 6.5 | % | 5-8 | % | Liver metabolism; | DRUGBANK |
| Clearance | 0.0618 | L/h/kg | 1.03 | ml/min/kg | Total clearance; | DRUGBANK | Clearance | 1.9 | L/h/kg | 31.0 | ml/min/kg | Plasma clearance; | DRUGBANK |
| Volume of Distribution | 1.4 | L/kg | 1.3-1.5 | L/kg | DRUGBANK | Volume of Distribution | 55.5 | L/kg | 43-68 | L/kg | Total volume of distribution; | DRUGBANK |
| Half-life | 9.0 | h | 9(3.5-18) | h | terminal half-life; | DRUGBANK |
| Toxicity LD50 | 1963.0 | mg/kg | 1963.0 | mg/kg | PO, oral; mouse; | T3DB | Toxicity LD50 | 1833.0 | mg/kg | 1833.0 | mg/kg | PO, oral; Rattus, Rat; | T3DB | Toxicity LD50 | 2400.0 | mg/kg | >2400 | mg/kg | PO, oral; rabbit; | T3DB |
| Eliminate Route | 85.0 | % | 80-90 | % | Urinary excretion; Single dose; | DRUGBANK | Eliminate Route | 8.0 | % | 3-13 | % | Faeces excretion; Single dose; | DRUGBANK | Eliminate Route | 2.0 | % | <2 | % | Urinary excretion; Single dose; Unchanged drug; | DRUGBANK |
| Protein Binding | 96.0 | % | ~96 | % | plasma proteins; | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 30.0 | mg/day | 30 | mg/day | PO, oral | Restoril | temazepam | PDR |
| Max dose for elderly | 30.0 | mg/day | 30 | mg/day | PO, oral | Restoril | temazepam | PDR |