| Drug ID | DDPD00208 |
|
| Drug Name | Ticlopidine | |
| Molecular Weight | 263.786 | |
| Molecular Formula | C14H14ClNS | |
| CAS Number | 55142-85-3 | |
| SMILES | ClC1=CC=CC=C1CN1CCC2=C(C1)C=CS2 | |
| External Links | ||
| DRUGBANK | DB00208 | |
| PubChem Compound | 5472 | |
| PDR | 3029 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.9 | - | 2.9 | - | DRUGBANK |
| Melting Point | 1189.0 | ℃ | ~1189 | ℃ | From Remington: The Science and Practice of Pharmacy |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Absorption | 80.0 | % | >80 | % | PO, oral; food; | food ↑ ; | DRUGBANK |
| Half-life | 7.9 | h | ~7.9 | h | Single dose; adults; | DRUGBANK | Half-life | 12.6 | h | 12.6 | h | Single dose; Elderly; | DRUGBANK | Half-life | 96.0 | h | ~4 | day | adults; | DRUGBANK | Half-life | 120.0 | h | ~5 | day | Elderly; | DRUGBANK |
| Toxicity Lethal Dose | 160.0 | mg/kg | 160.0 | mg/kg | Oral single dose; Rattus, Rat; | DRUGBANK | Toxicity Lethal Dose | 500.0 | mg/kg | 500.0 | mg/kg | Oral single dose; mouse; | DRUGBANK |
| Eliminate Route | 60.0 | % | 60 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 23.0 | % | 23 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 98.0 | % | 98 | % | plasma proteins; | DRUGBANK | Protein Binding | 15.0 | % | ≤15 | % | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 500.0 | mg/day | 500 | mg/day | PO, oral | Ticlopidine Hydrochloride | ticlopidine hydrochloride | PDR |
| Max dose for elderly | 500.0 | mg/day | 500 | mg/day | PO, oral | Ticlopidine Hydrochloride | ticlopidine hydrochloride | PDR |