Basic Information
| Drug ID | DDPD00181 |
|
| Drug Name | Baclofen | |
| Molecular Weight | 213.661 | |
| Molecular Formula | C10H12ClNO2 | |
| CAS Number | 1134-47-0 | |
| SMILES | NCC(CC(O)=O)C1=CC=C(Cl)C=C1 | |
| External Links | ||
| DRUGBANK | DB00181 | |
| T3DB | T3D2554 | |
| PubChem Compound | 2284 | |
| PDR | 1058 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Caco-2 Permeability | 0.9 | - | 0.9 | - | https://www.ncbi.nlm.nih.gov/pmc/articles/PMC6186984/ |
| Log P | 1.3 | - | 1.3 | - | http://www.hmdb.ca/metabolites/HMDB0014327 |
| Melting Point | 207.0 | ℃ | 207 | ℃ | MSDS |
| pKa | 9.62 | - | 9.62 + 0.1 (amino group) | - | http://www.labriva.com/monographies/02242151eng.pdf |
| pKa | 3.87 | - | 3.87 + 0.1 (carboxyl group) | - | http://www.labriva.com/monographies/02242151eng.pdf |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | ~100 | % | PO, oral; increasing doses; | increasing doses ↓ ; | DRUGBANK |
| Bioavailability | 70.0 | % | >70 | % | PO, oral; | The Pharmacological Basis of Therapeutics | |
| C Max | 160.0 | ng/ml | 160±49 | ng/ml | Oral single dose; | The Pharmacological Basis of Therapeutics | |
| T Max | 1.0 | h | 1.0(0.5-4) | h | Oral single dose; | The Pharmacological Basis of Therapeutics | |
| Metabolic | 15.0 | % | 15 | % | Liver metabolism; | DRUGBANK | |
| Metabolic | 85.0 | % | 85 | % | Renal metabolism; Urinary excretion; Faeces excretion; | DRUGBANK | |
| Clearance | 10.8 | L/h | 180.0 | ml/min | Total clearance; | DRUGBANK | |
| Clearance | 6.2 | L/h | 103.0 | ml/min | Renal clearance; | DRUGBANK | |
| Clearance | 0.16 | L/h/kg | 2.72±0.93 | ml/min/kg | apparent clearance; Rectal Administration; normal,healthy; Male, men; adults; | RD, renal impairment, Renal disease，including uremia ↓ ; | The Pharmacological Basis of Therapeutics |
| Clearance | 0.10 | L/h/kg | 1.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 59.0 | L | 59.0 | L | Apparent volume of distribution; | DRUGBANK | |
| Volume of Distribution | 0.81 | L/kg | 0.81±0.12 | L/kg | Apparent volume of distribution; Rectal Administration; normal,healthy; Male, men; adults; | The Pharmacological Basis of Therapeutics | |
| Volume of Distribution | 0.65 | L/kg | 0.65 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Half-life | 5.5 | h | ~5.5 | h | elimination half-life; | DRUGBANK | |
| Half-life | 3.8 | h | 3.75±0.96 | h | normal,healthy; adults; Male, men; | The Pharmacological Basis of Therapeutics | |
| Half-life | 5.2 | h | 5.24 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Toxicity LD50 | 145.0 | mg/kg | 145.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | |
| Toxicity LD50 | 45.0 | mg/kg | 45.0 | mg/kg | intravenous injection, IV; mouse; | T3DB | |
| Toxicity LD50 | 78.0 | mg/kg | 78.0 | mg/kg | intravenous injection, IV; Rattus, Rat; | T3DB | |
| Eliminate Route | 75.0 | % | 70-80 | % | Urinary excretion; Unchanged drug; | DRUGBANK | |
| Eliminate Route | 69.0 | % | 69±14 | % | Urinary excretion; Male, men; normal,healthy; human, homo sapiens; Unchanged drug; | The Pharmacological Basis of Therapeutics | |
| Protein Binding | 30.0 | % | 30 | % | DRUGBANK | ||
| Protein Binding | 31.0 | % | 31±11 | % | adults; Male, men; normal,healthy; human, homo sapiens; | The Pharmacological Basis of Therapeutics |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 60.0 | mg/day | 60 | mg/day | PO, oral | Baclofen | baclofen | PDR |
| Max dose for children | 40.0 | mg/day | 40 | mg/day | PO, oral | Baclofen | baclofen | PDR |
| Max dose for adolescents | 80.0 | mg/day | 80 | mg/day | PO, oral | Baclofen | baclofen | PDR |
| Max dose for adolescents | 150.0 | mg/day | 150 | mg/day | PO, oral | Baclofen | baclofen | PDR |
| Max dose for adults | 80.0 | mg/day | 80 | mg/day | PO, oral | Baclofen | baclofen | PDR |
| Max dose for adults | 150.0 | mg/day | 150 | mg/day | PO, oral | Baclofen | baclofen | PDR |
| Max dose for geriatric | 80.0 | mg/day | 80 | mg/day | PO, oral | Baclofen | baclofen | PDR |
| Max dose for geriatric | 150.0 | mg/day | 150 | mg/day | PO, oral | Baclofen | baclofen | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1