| Drug ID | DDPD00035 |
|
| Drug Name | Desmopressin | |
| Molecular Weight | 1069.22 | |
| Molecular Formula | C46H64N14O12S2 | |
| CAS Number | 16679-58-6 | |
| SMILES | NC(=O)CC[C@@H]1NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC2=CC=C(O)C=C2)NC(=O)CCSSC[C@H](NC(=O)[C@H](CC(N)=O)NC1=O)C(=O)N1CCC[C@H]1C(=O)N[C@H](CCCNC(N)=N)C(=O)NCC(N)=O | |
| External Links | ||
| DRUGBANK | DB00035 | |
| PDR | 1034 | |
| Drugs.com | Drugs.com Drug Page | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 3.7 | % | 3.3-4.1 | % | inhalation, IH; | DRUGBANK | Bioavailability | 0.12 | % | 0.08-0.16 | % | PO, oral; | DRUGBANK |
| C Max | 0.004000 | ng/ml | 4.00±3.85 | pg/ml | inhalation, IH; | DRUGBANK | C Max | 0.009110 | ng/ml | 9.11±6.90 | pg/ml | inhalation, IH; | DRUGBANK |
| T Max | 0.25 | h | 0.25 | h | inhalation, IH; | DRUGBANK | T Max | 0.75 | h | 0.75 | h | inhalation, IH; | DRUGBANK | T Max | 2.0 | h | 2 | h | PO, oral; | DRUGBANK |
| Metabolic | 0 | % | 0.0 | % | Liver metabolism; | DRUGBANK |
| Clearance | 0.0840 | L/h/kg | 1.4 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.26 | L/kg | 0.2–0.32 | L/kg | PO, oral; | DRUGBANK | Volume of Distribution | 0.30 | L/kg | 0.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.8 | h | 2.8 | h | terminal half-life; inhalation, IH; | DRUGBANK | Half-life | 3.0 | h | 3.0 | h | normal,healthy; | DRUGBANK | Half-life | 9.0 | h | 9.0 | h | severe renal function; | DRUGBANK | Half-life | 2.6 | h | 2-3.11 | h | PO, oral; | DRUGBANK | Half-life | 3.0 | h | 3 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity TDLo | 0.000001 | mg/kg/dayay | 0.3 | ug/kg/10M | intravenous injection, IV; human, homo sapiens; | DRUGBANK |
| Eliminate Route | 95.0 | % | ~95 | % | Urinary excretion; PO, oral; | DRUGBANK |
| Protein Binding | 17.3 | % | 17.3±1.5 | % | plasma proteins; normal,healthy; human, homo sapiens; | DRUGBANK |
Not Available